2-(Chloromethyl)-3,4-dimethoxypyridine Hydrochloride
2-Chloromethyl-3,4-dimethoxypyridine-[d7] Hydrochloride, exhibits special chemical structure, might be a compound useful in organic synthesis of some deuterium labelled inhibitor.
| Catalog Number | INT72830092 |
| Alternative Name(s) | 2-(Chloromethyl)-3,4-dimethoxypyridine Hydrochloride 2-Chloromethyl-3,4-dimethoxypyridine Hydrochloride 2-Chloromethyl-3,4-dimethoxypyridinium chloride 2-Chloromethyl-3,4-dimethoxy pyridine hydrochloride |
| Research Area | Intermediates |
| Molecular Formula | C8H11Cl2NO2 |
| CAS# | 72830-09-2 |
| SMILES | COC1=C(C(=NC=C1)CCl)OC.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/2-chloromethyl-34-dimethoxypyridine-hydrochloride-item-11188.html |