dUTP trisodium salt
DUTP is a deoxyuridine phosphate having a triphosphate group at the 5′-position. It has a role as a human metabolite, an Escherichia coli metabolite, a mouse metabolite and an Arabidopsis thaliana metabolite. It is a pyrimidine 2′-deoxyribonucleoside 5′-triphosphate and a deoxyuridine phosphate. It is a conjugate acid of a dUTP(3-).
| Catalog Number | PIPB-0487 |
| Alternative Name(s) | dUTP Deoxyuridine triphosphate 2'-Deoxyuridine 5'-triphosphate DEOXYURIDINE-5'-TRIPHOSPHATE |
| Research Area | In Vitro Diagnostics Reagents |
| Molecular Formula | C9H15N2O14P3 |
| CAS# | 102814-08-4 |
| SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dutp-trisodium-salt-item-10605.html |