dATP trisodium salt
This compound serves as a pivotal cog in DNA and RNA synthesis. Its function transcends mere chemical reactions, as it diligently enables the intricate transfer of genetic information within cellular metabolism. Furthermore, its intricate involvement extends to the therapeutic landscape, where it exhibits formidable potential in combating viral infections, metabolic aberrations, and select cancer subtypes.
Catalog Number | PIPB-0485 |
Alternative Name(s) | 2'-Deoxyadenosine-5'-diphosphate sodium salt 2/'-Deoxyadenosine-5/'-diphosphate disodium salt Sodium ((2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl hydrogendiphosphate disodium;[[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate |
Research Area | In Vitro Diagnostics Reagents |
Molecular Formula | C10H13N5Na2O9P2 |
CAS# | 72003-83-9 |
SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)([O-])OP(=O)(O)[O-])O.[Na+].[Na+] |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/datp-trisodium-salt-item-10603.html |