dIMP.Na2
2′-Deoxyinosine-5′-monophosphate disodium salt is an indispensable constituent in the biomedical sector assuming the role of a forerunner in fabricating curative nucleoside analogs targeted to diverse viral afflictions, such as HIV and herpes.
| Catalog Number | PIPB-0475 |
| Alternative Name(s) | Sodium ((2R,3S,5R)-3-hydroxy-5-(6-oxo-1H-purin-9(6H)-yl)tetrahydrofuran-2-yl)methyl phosphate 2'-Deoxyinosine 5'-monophosphate disodium salt 2'-Deoxyinosine-5'-monophosphate disodium salt 2/'-Deoxyinosine 5/'-monophosphate disodium salt |
| Research Area | dNMP&NMP |
| Molecular Formula | C10H11N4Na2O7P |
| CAS# | 14999-52-1 |
| SMILES | C1C(C(OC1N2C=NC3=C2N=CNC3=O)COP(=O)([O-])[O-])O.[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dimpna2-item-10593.html |