dUMP. Na2
dUMP. Na2 is an indispensable precursor within the nucleotide research and development pathway, assuming a pivotal role in facilitating the comprehension of intricate DNA replication and repair mechanisms.
| Catalog Number | PIPB-0474 |
| Alternative Name(s) | Disodium 2'-deoxyuridylate 2'-Deoxyuridine 5'-monophosphate disodium salt sodium ((2R,3S,5R)-5-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-3-hydroxytetrahydrofuran-2-yl)methyl phosphate 5'-Uridylic acid, 2'-deoxy-, disodium salt |
| Research Area | dNMP&NMP |
| Molecular Formula | C9H11N2Na2O8P |
| CAS# | 42155-08-8 |
| SMILES | C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)([O-])[O-])O.[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dump-na2-item-10592.html |