dAMP. Na2
It displays its profound potential as a nucleotide analogue, contributing extensively to the management of diverse ailments such as viral infections and select malignancies. With improved stability and solubility attributed to its disodium salt form, this compound emerges as an optimal preference within the biomedical realm, particularly for research and pharmaceutical purposes.
| Catalog Number | PIPB-0473 |
| Alternative Name(s) | Sodium ((2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl phosphate 2'-deoxyadenosine-5'-monophosphate disodium salt 151151-31-4 2'-deoxyadenosine 5'-monophosphate disodium salt |
| Research Area | dNMP&NMP |
| Molecular Formula | C10H12N5Na2O6P |
| CAS# | 2922-74-9 |
| SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)([O-])[O-])O.[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/damp-na2-item-10591.html |