dCTP
A metabolite of 2′-Deoxycytidine. A nucleoside triphosphate that is used whenever DNA is synthesized, such as in the polymerase chain reaction.
| Catalog Number | PIPB-0423 |
| Alternative Name(s) | 2'-Deoxycytidine 5'-triphosphate disodium salt 2'-Deoxycytidine-5'-triphosphoric acid disodium salt Disodium;[[[(2R,3S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-oxidophosphoryl] hydrogen phosphate dCTP-Na2 |
| Research Area | dNTP |
| Molecular Formula | C9H14N3Na2O13P3 |
| CAS# | 102783-51-7 |
| SMILES | C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)([O-])OP(=O)(O)[O-])O.[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dctp-item-10541.html |