dATP
DATP is a purine 2′-deoxyribonucleoside 5′-triphosphate having adenine as the nucleobase. It has a role as an Escherichia coli metabolite and a mouse metabolite. It is a purine 2′-deoxyribonucleoside 5′-triphosphate and a 2′-deoxyadenosine 5′-phosphate. It is a conjugate acid of a dATP(3-).
| Catalog Number | PIPB-0422 |
| Alternative Name(s) | 67460-17-7 2'-deoxyadenosine 5'-triphosphate Deoxyadenosine triphosphate 2'-deoxyadenosine triphosphate |
| Research Area | dNTP |
| Molecular Formula | C10H16N5O12P3 |
| CAS# | 1927-31-7 |
| SMILES | C1C(C(OC1N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/datp-item-10540.html |