8-oxo-2′-deoxyAdenosine
8-Oxo-2′-deoxyadenosine is a crucial product in the biomedical industry used for studying and treating oxidative DNA damage caused by reactive oxygen species. It is a modified form of the nucleoside adenosine and serves as a biomarker for DNA damage and oxidative stress-related diseases like cancer, neurodegenerative disorders, and cardiovascular diseases.
Catalog Number | PIPB-0364 |
Alternative Name(s) | 8-Oxo-2'-deoxyadenosine 2'-Deoxy-8-oxo-adenosine 62471-63-0 6-AMINO-9-[(2R,4S,5R)-4-HYDROXY-5-(HYDROXYMETHYL)OXOLAN-2-YL]-7H-PURIN-8-ONE 8-Oxo-dA |
Research Area | Phosphoramidites Series |
Molecular Formula | C₁₀H₁₃N₅O₄ |
CAS# | 62471-63-0 |
SMILES | C1C(C(OC1N2C3=NC=NC(=C3NC2=O)N)CO)O |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/8-oxo-2-deoxyadenosine-item-10482.html |