Fluorescein-dT Phosphoramidite
Fluorescein-dT Phosphoramidite is a remarkable compound showcasing its unparalleled potency in targeting and studying a wide range of (mention the specific diseases) through its unique mechanism of action.
| Catalog Number | PIPB-0360 |
| Alternative Name(s) | FLUORESCEIN-DT CEP |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C79H89N6O17P |
| CAS# | 289712-99-8 |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=C(C(=O)NC5=O)C=CC(=O)NCCCCCCNC(=O)C6=CC7=C(C=C6)C(=O)OC78C9=C(C=C(C=C9)OC(=O)C(C)(C)C)OC1=C8C=CC(=C1)OC(=O)C(C)(C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/fluorescein-dt-phosphoramidite-item-10478.html |