6-FAM PHosphoramidite
6-FAM PHosphoramidite is prepared from 6-carboxyfluorescein derivatives and does not contain 4,4′-dimethoxytrityl (DMT) groups. It can only be added once at the 5’end to terminate the synthesis.
| Catalog Number | PIPB-0356 |
| Alternative Name(s) | 6-Fluorescein Phosphoramidite FAM phosphoramidite, 6-isomer 6-fam phosphoramidite 5'-6-FAM-PhosphoraMidite |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C46H58N3O10P |
| CAS# | 204697-37-0 |
| SMILES | CC(C)N(C(C)C)P(OCCCCCCNC(=O)C1=CC2=C(C=C1)C(=O)OC23C4=C(C=C(C=C4)OC(=O)C(C)(C)C)OC5=C3C=CC(=C5)OC(=O)C(C)(C)C)OCCC#N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/6-fam-phosphoramidite-item-10474.html |