UNA-A(Bz)-CE Phosphoramidite
UNA-A(Bz)-CE Phosphoramidite is an advanced biomedical compound used for the research of cancer, including breast and lung cancer. It acts by targeting specific cellular pathways involved in cancer progression, inhibiting tumor growth and promoting cell death.
| Catalog Number | PIPB-0341 |
| Alternative Name(s) | EX-A7174L (2R)-2-(6-Benzamido-9H-purin-9-yl)-2-(((2R)-1-(bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)ethyl benzoate N6-benzoyl-5'-(4,4'-dimethoxytrityl)-2'-benzoyl-2',3'-seco-adenosine-3'-cyanoethyl Phosphoramidite |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C54H58N7O9P |
| CAS# | 1120329-52-3 |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)OC(COC(=O)C4=CC=CC=C4)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/una-abz-ce-phosphoramidite-item-10459.html |