N6-Bz-A-(S)-GNA Phosphoramidite
N6-Bz-A-(S)-GNA Phosphoramidite is a chemical utilized in the synthesis of oligonucleotides for molecular biology study, imitates nucleotide bases to scrutinize RNA/DNA structure and function. Furthermore, it assists in the creation of disease-specific gene-targeting medications.
| Catalog Number | PIPB-0337 |
| Alternative Name(s) | (S)-GNA-A(Bz)-phosphoramidite EX-A7174D BP-29979 N-Benzoyl-9-[(S)-2-[[(diisopropylamino)(2-cyanoethoxy)phosphino]oxy]-3-[(4,4'-dimethoxytrityl)oxy]propyl]-9H-purine-6-amine |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C45H50N7O6P |
| CAS# | 851050-24-3 |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC(CN1C=NC2=C(N=CN=C21)NC(=O)C3=CC=CC=C3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/n6-bz-a-s-gna-phosphoramidite-item-10455.html |