DMT-2′-O-Me-I-CE Phosphoramidite

DMT-2′-O-Me-I-CE Phosphoramidite is a vital component used in the research and development of RNA molecules for biomedical research. It functions as a phosphoramidite building block to introduce the modified nucleoside 5′-O-DMT-2′-O-methylinosine into RNA sequences. This modified nucleoside plays a crucial role in studying the structure, function and therapeutic potential of RNA molecules involved in various diseases, including cancer and genetic disorders.

Catalog Number PIPB-0312
Alternative Name(s) 2/'-O-METHYL-I CEP 3-[[(2R,3R,4R,5R)-2-[[Bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-methoxy-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile 2'-O-METHYL-5'-O-DMT-INOSINE-3'-CE-PHOSPHORAMIDITE DTXSID801106996
Research Area Phosphoramidites Series
Molecular Formula C41H49N6O8P
CAS# 128219-85-2
SMILES CC(C)N(C(C)C)P(OCCC#N)OC1C(OC(C1OC)N2C=NC3=C2N=CNC3=O)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC
Size inquiry
Supplier Page https://www.protheragen-ing.com/dmt-2-o-me-i-ce-phosphoramidite-item-10430.html