DMT-dI-CE Phosphoramidite
5′-O-DMT-2′-deoxyinosine 3′-CE phosphoramidite is a key reagent used in the biomedical industry for the synthesis of modified nucleosides. It is commonly employed in the development of DNA and RNA molecules for research purposes, such as studying DNA-protein interactions or designing gene therapies. Its unique chemical structure enables specific targeting and modulation of gene expression related to certain diseases, providing insights into novel treatment strategies.
Catalog Number | PIPB-0287 |
Alternative Name(s) | DMT-dI Phosphoramidite Inosine (dI) phosphoramidite (2R,3S,5R)-2-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite 3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
Research Area | Phosphoramidites Series |
Molecular Formula | C40H47N6O7P |
CAS# | 141684-35-7 |
SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C5N=CNC6=O |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/dmt-di-ce-phosphoramidite-item-10405.html |