Bz-dA Phosphoramidite
5′-O-DMT-N6-Benzoyl-2′-deoxyadenosine 3′-CE phosphoramidite, an indispensable biomolecular tool, profoundly impacts the dynamic biomedical sphere. Its paramount significance lies in its pivotal role as a reagent for nucleoside or oligonucleotide synthesis, revolutionizing the study of DNA-protein interactions, gene expression, and research in molecular biology.
| Catalog Number | PIPB-0261 |
| Alternative Name(s) | DMT-dA(bz) Phosphoramidite 5'-O-(4,4'-Dimethoxytrityl)-N6-benzoyl-2'-deoxyadenosine-3'-(2-cyanoethyl-N,N-diisopropyl)phosphoramidite N6-Benzoyl-2'-deoxy-5'-O-DMT-adenosine 3'-CE phosphoramidite DMT-dA(bz) Pharmadite(R) |
| Research Area | Phosphoramidites Series |
| Molecular Formula | C47H52N7O7P |
| CAS# | 98796-53-3 |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/bz-da-phosphoramidite-item-10379.html |