N-Acetyl-DL-tryptophan
N-acetyltryptophan is an N-acetylamino acid that is the N-acetyl derivative of tryptophan. It has a role as a metabolite. It is a N-acetyl-amino acid and a tryptophan derivative. It is a conjugate acid of a N-acetyltryptophanate.
| Catalog Number | PIPB-0112 |
| Alternative Name(s) | N-Acetyl-DL-tryptophan Ac-DL-Trp-OH N-Acetyltryptophan acetyltryptophan |
| Research Area | Amino acids and derivatives |
| Molecular Formula | C13H14N2O3 |
| CAS# | 87-32-1 |
| SMILES | CC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/n-acetyl-dl-tryptophan-item-10230.html |