Monosodium Citrate Anhydrous
Sodium salts of citric acid that are used as buffers and food preservatives. They are used medically as anticoagulants in stored blood, and for urine alkalization in the prevention of KIDNEY STONES.
| Catalog Number | PIE-0181 |
| Alternative Name(s) | Monosodium citrate Sodium dihydrogen citrate sodium 3,4-dicarboxy-3-hydroxybutanoate Citric acid monosodium salt |
| Research Area | Pharmaceutical Excipients |
| Molecular Formula | C6H7O7Na |
| CAS# | 18996-35-5 |
| SMILES | C(C(=O)O)C(CC(=O)[O-])(C(=O)O)O.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/monosodium-citrate-anhydrous-item-10185.html |