Citric Acid Anhydrous
Citric acid anhydrous is non-toxic and has a low reactivity. It is chemically stable if stored at ambient temperatures. Citric acid anhydrous is fully biodegradable and can be disposed of with regular waste or sewage.
| Catalog Number | PIE-0178 |
| Alternative Name(s) | citric acid Citric acid, anhydrous 2-hydroxypropane-1,2,3-tricarboxylic acid Anhydrous citric acid |
| Research Area | Pharmaceutical Excipients |
| Molecular Formula | C6H8O7 |
| CAS# | 77-92-9 |
| SMILES | C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/citric-acid-anhydrous-item-10182.html |