Polyglutamic acid
Polyglutamic acid , a poly amino acid produced by Bacillus spp. is a naturally occurring anionic, water-soluble, biodegradable, non-toxic, viscous, edible biopolymer containing D and L-glutamic acid residues with different industrial applications.
| Catalog Number | CIA25513466 |
| Alternative Name(s) | L-GLU-(L-GLU)N-L-GLU;alpha-l-glutamicacidpolymer;glutamicacidpolymer;Poly-γ-Glutamic Acid(γ-PGA);γ-poly(L-glutamic acid) macromolecule |
| Research Area | Cosmetic Ingredients and Additives |
| Molecular Formula | C5H9NO4 |
| CAS# | 25513-46-6 |
| Inchi Key | WHUUTDBJXJRKMK-ZJPLZJKBNA-N |
| SMILES | [C@@H](N)(C(=O)O)CCC(=O)O |&1:0,r| |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/polyglutamic-acid-item-9776.html |