Rhoifolin
Apigenin 7-O-neohesperidoside is an apigenin derivative having an alpha-(1->2)-L-rhamnopyranosyl)-beta-D-glucopyranosyl moiety attached to the 7-hydroxy group. It has a role as a metabolite. It is a neohesperidoside, a dihydroxyflavone and a glycosyloxyflavone. It is functionally related to an apigenin.
| Catalog Number | PIPE-0754 |
| Alternative Name(s) | Rhoifoloside Apigenin 7-O-neohesperidoside Apigenin-7-O-rhamnoglucoside |
| Research Area | Natural Extract |
| Molecular Formula | C27H30O14 |
| CAS# | 17306-46-6 |
| Purity | 0.98% |
| SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)O)O)CO)O)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/rhoifolin-item-9693.html |