Linarin
Linarin is a flavone glycoside isolated from the herb of Uncaria sinensis (Oliv.) Havil. It is also an impurity of Diosmin, a medication used for the treatment of various disorders of blood vessels.
| Catalog Number | PIPE-0724 |
| Alternative Name(s) | Buddleoside Acaciin Linarine |
| Research Area | Natural Extract |
| Molecular Formula | C28H32O14 |
| CAS# | 480-36-4 |
| Purity | 0.98% |
| SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/linarin-item-9663.html |