Genistein
It is a phytoestrogenic isoflavone with antioxidant properties. It has a role as an antineoplastic agent, a tyrosine kinase inhibitor, an EC 5.99.1.3 [DNA topoisomerase (ATP-hydrolysing)] inhibitor, a phytoestrogen, a plant metabolite, a geroprotector and a human urinary metabolite. It is a conjugate acid of a genistein(1-).
| Catalog Number | PIPE-0676 |
| Alternative Name(s) | Prunetol 4',5,7-Trihydroxyisoflavone Genisterin |
| Research Area | Natural Extract |
| Molecular Formula | C15H10O5 |
| CAS# | 446-72-0 |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/genistein-item-9615.html |