Sodium Danshensu
Sodium Danshensu is a mono sodium of danshensu, which is a natural phenolic acid of caffeic acid derivatives isolated from Salvia miltiorrhiza.
| Catalog Number | PIPE-0669 |
| Alternative Name(s) | Danshensu sodium salt sodium 3-(3,4-dihydroxyphenyl)-2-hydroxypropanoate Danshensu (sodium salt) |
| Research Area | Natural Extract |
| Molecular Formula | C9H9NaO5 |
| CAS# | 67920-52-9 |
| SMILES | C1=CC(=C(C=C1CC(C(=O)[O-])O)O)O.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/sodium-danshensu-item-9608.html |