Dehydrocostus lactone
It has a role as a metabolite, a trypanocidal drug, an antineoplastic agent, a cyclooxygenase 2 inhibitor, an antimycobacterial drug and an apoptosis inducer. It is a sesquiterpene lactone, a guaiane sesquiterpenoid, an organic heterotricyclic compound and a gamma-lactone.
| Catalog Number | PIPE-0625 |
| Alternative Name(s) | dehydrocostuslactone Epiligulyl oxide (-)-dehydrocostus lactone |
| Research Area | Natural Extract |
| Molecular Formula | C15H18O2 |
| CAS# | 477-43-0 |
| SMILES | C=C1CCC2C(C3C1CCC3=C)OC(=O)C2=C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dehydrocostus-lactone-item-9564.html |