Oxysophocarpine
Sophocarpidine comes from the root of Styphnolobium japonicum (L.) Schott. Sophocarpine could decrease the level of serum transaminase, improve lipid metabolism, reduce synthesis of inflammatory cytokines TNF-α, TGF-β1 and IL-6, activate protective adipocytokine adiponectin, might be a drug for colonic inflammation and NASH.
| Catalog Number | PIPE-0590 |
| Alternative Name(s) | Sophocarpine N-oxide 58BVU7200M Matridin-15-one, 13,14-didehydro-, 1-oxide |
| Research Area | Natural Extract |
| Molecular Formula | C15H22N2O2 |
| CAS# | 26904-64-3 |
| SMILES | C1CC2CN3C(CC=CC3=O)C4C2[N+](C1)(CCC4)[O-] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/oxysophocarpine-item-9529.html |