Oleanolic acid
Oleanolic acid is a pentacyclic triterpenoid that is olean-12-en-28-oic acid substituted by a beta-hydroxy group at position 3. It has a role as a plant metabolite. It is a pentacyclic triterpenoid and a hydroxy monocarboxylic acid. It is a conjugate acid of an oleanolate. It derives from a hydride of an oleanane.
| Catalog Number | PIPE-0582 |
| Alternative Name(s) | Oleanic acid Caryophyllin Astrantiagenin C |
| Research Area | Natural Extract |
| Molecular Formula | C30H48O3 |
| CAS# | 508-02-1 |
| SMILES | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1)C)C(=O)O)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/oleanolic-acid-item-9521.html |