5,7-DIMETHOXYFLAVONE
Chrysin 5,7-dimethyl ether is a dimethoxyflavone that is the 5,7-dimethyl ether derivative of chrysin. It has a role as a plant metabolite. It is functionally related to a chrysin.
| Catalog Number | PIPE-0539 |
| Alternative Name(s) | Chrysin dimethyl ether Chrysin dimethylether Chrysin 5,7-dimethyl ether |
| Research Area | Natural Extract |
| Molecular Formula | C17H14O4 |
| CAS# | 21392-57-4 |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)C3=CC=CC=C3 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/57-dimethoxyflavone-item-9478.html |