Quillaic acid
It has a role as an anti-inflammatory agent and a metabolite. It is a pentacyclic triterpenoid, a hydroxy monocarboxylic acid and an aldehyde. It is a conjugate acid of a quillate. It derives from a hydride of an oleanane.
| Catalog Number | PIPE-0529 |
| Alternative Name(s) | (3beta,4alpha,16alpha)-3,16-Dihydroxy-23-oxoolean-12-en-28-oic acid CHEBI:8710 69O8E4G02B |
| Research Area | Natural Extract |
| Molecular Formula | C30H46O5 |
| CAS# | 631-01-6 |
| SMILES | CC1(CCC2(C(C1)C3=CCC4C5(CCC(C(C5CCC4(C3(CC2O)C)C)(C)C=O)O)C)C(=O)O)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/quillaic-acid-item-9468.html |