Liquiritigenin
Liquiritigenin is a dihydroxyflavanone compound having the two hydroxy substituents at the 4′- and 7-positions. Isolated from the root of Glycyrrhizae uralensis, it is a selective agonist for oestrogen receptor beta. It has a role as a hormone agonist and a plant metabolite.
| Catalog Number | PIPE-0511 |
| Alternative Name(s) | 4',7-Dihydroxyflavanone (S)-7-Hydroxy-2-(4-hydroxyphenyl)chroman-4-one (2S)-liquiritigenin |
| Research Area | Natural Extract |
| Molecular Formula | C15H12O4 |
| CAS# | 578-86-9 |
| SMILES | C1C(OC2=C(C1=O)C=CC(=C2)O)C3=CC=C(C=C3)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/liquiritigenin-item-9450.html |