4,4′-Difluorobnzophenone
4,4′-Difluorobenzophenone (CAS# 345-92-6) is used as a reagent in the synthesis of diphenylmethoxypiperidine-derived dopamine uptake inhibitors. Also used as a reagent in the synthesis of 1-benzhydryl piperazine derivatives which display ACE inhibitor and antimicrobial activity.
| Catalog Number | INT345926 |
| Alternative Name(s) | Bis(4-fluorophenyl)methanone bis(4-fluorophenyl)-methanone Methanone, bis(4-fluorophenyl)- |
| Research Area | Intermediates |
| Molecular Formula | C13H8F2O |
| CAS# | 345-92-6 |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)F)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/44-difluorobnzophenone-item-9229.html |