Retinoic Acid(Tretinoin)
Tretinoin is a generic name for a medication derivative of vitamin A (retinol), also commonly known as all-trans retinoic acid (ATRA). Tretinoin can be given systemically or topically for various indications. Adjunctive palliative treatment of photoaging: Fine facial wrinkles
| Catalog Number | INT302794 |
| Alternative Name(s) | Retinoic acid tretinoin all-trans-Retinoic acid Vitamin A acid |
| Research Area | Intermediates |
| Molecular Formula | C20H28O2 |
| CAS# | 302-79-4 |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/retinoic-acidtretinoin-item-9189.html |