Eicosanedioic acid
Icosanedioic acid is an alpha,omega-dicarboxylic acid that is the 1,18-dicarboxy derivative of octadecane. It has a role as a metabolite. It is a conjugate acid of an icosanedioic acid anion. It derives from a hydride of an icosane.
| Catalog Number | INT2424922 |
| Alternative Name(s) | Icosanedioic acid 1,18-octadecanedicarboxylic acid Eicosanedioicacid |
| Research Area | Intermediates |
| Molecular Formula | C20H38O4 |
| CAS# | 2424-92-2 |
| SMILES | C(CCCCCCCCCC(=O)O)CCCCCCCCC(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/eicosanedioic-acid-item-9147.html |