2-Chloro-5-Nitrobenzoic Acid
2-Chloro-5-nitrobenzoic Acid is used in the synthesis of sesquiterpenoids as potential antibacterial compounds. It is also used in the synthesis of substituted phenyl oxazoles as novel LSD1 inhibitors with antiproliferative activity.
| Catalog Number | INT2516963 |
| Alternative Name(s) | Benzoic acid, 2-chloro-5-nitro- 2-Chloro-5-nitrobenzoicacid 6-Chloro-3-nitrobenzoic acid |
| Research Area | Intermediates |
| Molecular Formula | C7H4ClNO4 |
| CAS# | 2516-96-3 |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/2-chloro-5-nitrobenzoic-acid-item-7333.html |