tBuXPhos Pd G3
tBuXPhos Pd G3 is an organometollic compound, which is an excellent reagent for Buchwaldd-Hartwig cross-coupling reaction, with lower catalyst loading, shorter reaction time, effective formation of active catalytic species and precise control of the ligand-to-palladium ratio.
| Catalog Number | CHE1447963758 |
| Alternative Name(s) | Methanesulfonato(2-di-t-butylphosphino-2',4',6'-tri-i-propyl-1,1'-biphenyl)(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) |
| Research Area | Chemicals |
| Molecular Formula | C42H58NO3PPdS |
| CAS# | 1447963-75-8 |
| SMILES | P(C1C=CC=CC=1C1C(=CC(C(C)C)=CC=1C(C)C)C(C)C)([Pd+2]1(NC2=CC=CC=C2C2=CC=CC=[C-]12)[O-]S(=O)(=O)C)(C(C)(C)C)C(C)(C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/tbuxphos-pd-g3-item-6479.html |