Celecoxib
Celecoxib, a selective cyclooxygenase-2 (COX-2) inhibitor, is a nonsteroidal anti-inflammatory drug (NSAID) which is known for its decreased risk of causing gastrointestinal bleeding compared to other NSAIDS. It is used to manage symptoms of various types of arthritis pain and in familial adenomatous polyposis (FAP) to reduce precancerous polyps in the colon.
| Catalog Number | API169590425 |
| Alternative Name(s) | Celebrex;Celebra;Onsenal |
| Research Area | Nonsteroidal Anti-inflammatory (NSAID) APIs |
| Molecular Formula | C17H14F3N3O2S |
| CAS# | 169590-42-5 |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/celecoxib-item-6230.html |