Dexamethasone Acetate
The acetate-protect form of Dexamethasone which is a glucocorticoid and could be used as an anti-inflammatory agent. It can be used for various inflammations, allergic diseases, bovine ketoneemia, sheep pregnancy toxemia, and can also be used for the simultaneous delivery of female animals.
| Catalog Number | API1177873 |
| Alternative Name(s) | Dexamethasone 21-acetate Decadronal Decadron-LA |
| Research Area | GlucocorticoidsCorticosteroids APIs |
| Molecular Formula | C24H31FO6 |
| CAS# | 1177-87-3 |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COC(=O)C)O)C)O)F)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dexamethasone-acetate-item-6050.html |