Neosigmine Methylsulfate
A cholinesterase inhibitor used in the treatment of myasthenia gravis and to reverse the effects of muscle relaxants such as gallamine and tubocurarine. Neostigmine, unlike PHYSOSTIGMINE, does not cross the blood-brain barrier.
| Catalog Number | API51605 |
| Alternative Name(s) | Neostigmine methyl sulfate NEOSTIGMINE METHYLSULFATE Syntostigmin Hodostin |
| Research Area | Anti-Duchenne Muscular Dystrophy APIs |
| Molecular Formula | C13H22N2O6S |
| CAS# | 51-60-5 |
| SMILES | CN(C)C(=O)OC1=CC=CC(=C1)[N+](C)(C)C.COS(=O)(=O)[O-] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/neosigmine-methylsulfate-item-6014.html |