Tamoxifen citrate
Antineoplastic, an estrogen-competitive antagonist, is a non-steroidal anti-estrogen drug that competes with estrogen (estradiol) in the body and binds to the estrogen receptor of breast cancer cells, thereby inhibiting the action of estrogen on cancer cells.
| Catalog Number | API54965241 |
| Alternative Name(s) | Istubal Zitazonium Kessar |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C32H37NO8 |
| CAS# | 54965-24-1 |
| SMILES | CCC(=C(C1=CC=CC=C1)C2=CC=C(C=C2)OCCN(C)C)C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/tamoxifen-citrate-item-5886.html |