Valencene
Valencene is the major sesquiterpene aroma constituent of orange peel oil. It is mainly used as a starting material to synthesize nootkatone, an important flavor compound of grapefruit.
| Catalog Number | CDC10-0197 |
| Alternative Name(s) | (+)-Valencene, (3R,4aS,5R)-4a,5-Dimethyl-3-isopropenyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C15H24 |
| CAS# | 4630-07-3 |
| Inchi | 1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1 |
| SMILES | C[C@@H]1CCC=C2CC[C@H](C[C@@]12C)C(C)=C |
| EC Number | 225-047-6 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/valencene-item-2279.html |