Triclocarban
3,4,4′-Trichlorocarbanilide(TCC) is employed as bacteriostat and antimicrobial agent in bar soaps, cosmetics and other personal care prducts.TCC is a toxic, persistent and potentially bioaccumulative polychlorinated binuclear aromatic urea pesticide.
| Catalog Number | CDC10-0350 |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C13H9Cl3N2O |
| CAS# | 101-20-2 |
| Purity | 99.0% |
| Inchi | 1S/C13H9Cl3N2O/c14-8-1-3-9(4-2-8)17-13(19)18-10-5-6-11(15)12(16)7-10/h1-7H,(H2,17,18,19) |
| SMILES | Clc1ccc(NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/triclocarban-item-2432.html |