L-Ascorbic acid
L-ascorbic acid is used as a food additive, browning inhibitor, flavor stabilizer, dough modifier and color stabilizer. Deficiency of ascorbic acid is associated with scurvy. L-ascorbic acid stimulates immune response and is implicated in the synthesis of collagen, carnitine and neurotransmitters.
| Catalog Number | CDC10-0033 |
| Alternative Name(s) | L-Threoascorbic acid, Antiscorbutic factor, Vitamin C |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C6H8O6 |
| CAS# | 50-81-7 |
| Purity | 99.0% |
| SMILES | OC([C@]([C@@H](O)CO)([H])O1)=C(O)C1=O |
| EC Number | 200-066-2 |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/l-ascorbic-acid-item-2115.html |