Squoxin | MedChemExpress (MCE)
Squoxin (ST1859) is an antiamyloid agent that specifically binds to Aβ1-42 and prevents the aggregation and fibril formation of Aβ. Squoxin crosses the blood-brain barrier (BBB) and has anthelmintic activity and anti-inflammatory properties[1].
| Trivial name | Squoxin |
| Catalog Number | HY-W265961 |
| Alternative Name(s) | ST1859; 1,1′-Methylenedi-2-naphthol |
| Research Area | Neurological Disease; Inflammation/Immunology |
| CAS# | 1096-84-0 |
| Purity | ≥98.0% |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2CC3=C(C=CC4=CC=CC=C43)O)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/squoxin.html |
