Pneumolysin-IN-1 | MedChemExpress (MCE)
Pneumolysin-IN-1 (compound PB-3) is a targeted small molecule inhibitor of Pneumolysin (PLY) (IC50=3.1 µM). Pneumolysin-IN-1 is a pore blocking agent and an anti-virulence factor. Pneumolysin-IN-1 can be used to study the infection caused by Streptococcus pneumoniae[1].
| Trivial name | Pneumolysin-IN-1 |
| Catalog Number | HY-163542 |
| Research Area | Inflammation/Immunology |
| CAS# | 330842-49-4 |
| Purity | ≥98.0% |
| SMILES | O=C1NC(N(C2=CC(C)=CC(C)=C2)C(/C1=C/C3=CC=C(C4=C(Cl)C=C(Cl)C=C4)O3)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pneumolysin-in-1.html |