PDE1-IN-7 | MedChemExpress (MCE)
PDE1-IN-7 (Compound 13h) is a selective inhibitor of bPDE1 (IC50= 10 nM). PDE1-IN-7 exhibits significant anti-fibrotic effects in a BDL-induced liver fibrosis rat model. PDE1-IN-7 can be used for research in liver fibrosis[1].
| Trivial name | PDE1-IN-7 |
| Catalog Number | HY-161506 |
| Research Area | Inflammation/Immunology |
| CAS# | 3027833-49-1 |
| Purity | ≥98.0% |
| SMILES | O=C1N(C(C(C(OCC2CCCCC2)=O)=C(N1)C)C3=CC=C(C(OCC4CC4)=C3)OC(F)F)C(SCC5=CC=CC=C5)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pde1-in-7.html |