SDH-IN-15 | MedChemExpress (MCE)
SDH-IN-15 (Compound 5e) is an inhibitor of succinate dehydrogenase (SDH) (IC50=2.04 μM). SDH-IN-15 has significant antifungal activity. SDH-IN-15 blocks the mitochondrial respiratory chain of the fungus through inhibition of SDH, resulting in fungal death[1].
| Trivial name | SDH-IN-15 |
| Catalog Number | HY-158321 |
| Research Area | Infection |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CN(C)N=C1C(F)F)NC2=CC=CC=C2/C(C)=N/OCC3=CC=C(Br)C=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/sdh-in-15.html |
