AChE-IN-63 | MedChemExpress (MCE)
AChE-IN-63 (Compound 5AD) is a selective inhibitor of hAChE (IC50=0.103 μM). AChE-IN-63 also inhibits hBChE and hBACE-1 (IC50= 10 μM (hBChE); 1.342 μM (hBACE-1)). AChE-IN-63 inhibits Aβ aggregation, preventing the formation and deposition of Aβ1-42. AChE-IN-63 can effectively penetrate the blood-brain barrier and is orally effective. It is primarily used in Alzheimer’s disease research[1].
| Trivial name | AChE-IN-63 |
| Catalog Number | HY-158261 |
| Research Area | Neurological Disease |
| CAS# | 876685-78-8 |
| Purity | ≥98.0% |
| SMILES | C1(C2=NN=C(O2)CN3CCN(CC3)C4=CC=CC=N4)=CC=CC=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ache-in-63.html |