2-(tert-Butyl)-4-methoxyphenol | MedChemExpress (MCE)
2-tert-Butyl-4-methoxyphenol is a major component of Butylhydroxyanisole (BHA) (HY-B1066). 2-tert-Butyl-4-methoxyphenol is an antioxidant agent, that inhibits expression of Cox2 and Tnfa genes upon stimulation with Lipopolysaccharide (HY-D1056). 2-tert-Butyl-4-methoxyphenol exhibits anti-inflammatory activity, combined with 2,6-di-tert-butyl-4-methylphenol (BHT)[1].
| Trivial name | 2-(tert-Butyl)-4-methoxyphenol |
| Catalog Number | HY-W010037 |
| Research Area | Inflammation/Immunology |
| CAS# | 121-00-6 |
| Purity | ≥98.0% |
| SMILES | COC1=CC(=C(O)C=C1)C(C)(C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-tert-butyl-4-methoxyphenol.html |