BKIDC-1553 | MedChemExpress (MCE)
BKIDC-1553 is an orally active antiglycolytic agent and a bumped kinase inhibitor derived compound with a predicted ~17 h half-life in human. BKIDC-1553 inhibits CYP2C8 and Angiotensin Converting Enzyme and can be used for cancer research[1].
| Trivial name | BKIDC-1553 |
| Catalog Number | HY-163438 |
| Research Area | Cancer |
| CAS# | 1951431-34-7 |
| Purity | ≥98.0% |
| SMILES | OC(C)(CN1N=C(C2=C1N=CN=C2N)C3=CC4=C(C=C(C=C4)OC5CC5)C=C3)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bkidc-1553.html |