ChEs/MAOs-IN-2 | MedChemExpress (MCE)
ChEs/MAOs-IN-2 (compound a11) is a cholinesterases and monoamine oxidases inhibitor with IC50 value of 0.10, 0.20, 0.30, 0.40 µM for MAO-A, MAO-B, AChE, and BChE, respectively. ChEs/MAOs-IN-2 has the potential for the research of Alzheimer’s disease[1].
| Trivial name | ChEs/MAOs-IN-2 |
| Catalog Number | HY-158092 |
| Research Area | Neurological Disease |
| CAS# | 693268-77-8 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=C2N=CC=CC2=CC=C1)(NC3=CC=CC=C3O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ches-maos-in-2.html |